| Description: |
AG-1 is a Notch ligand highly expressed in cultured and primary multiple myeloma (MM) cells. JAG-1 induces maturation of monocyte-derived human dendritic cells. |
| Purity: |
0.9989 |
| Shipping: |
Room temperature in continental US; may vary elsewhere. |
| Storage: |
Sealed storage, away from moisture
Powder: -80°C, 2 years; -20°C, 1 year
In solvent : -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture) |
| Molecular Weight: |
2221.42 |
| Formula: |
C95H128F3N25O28S3 |
| Appearance: |
Solid |
| Color: |
White to off-white |
| Sequence Shortening: |
CDDYYYGFGCNKFCRPR |
| SMILES: |
O=C(O)C(F)(F)F.O=C(N[C@@H](CC(O)=O)C(N[C@@H](CC(O)=O)C(N[C@@H](CC1=CC=C(C=C1)O)C(N[C@@H](CC2=CC=C(C=C2)O)C(N[C@@H](CC3=CC=C(C=C3)O)C(NCC(N[C@@H](CC4=CC=CC=C4)C(NCC(N[C@@H](CS)C(N[C@@H](CC(N)=O)C(N[C@@H](CCCCN)C(N[C@@H](CC5=CC=CC=C5)C(N[C@@H](CS)C(N[C@@H](CCCNC(N)=N)C(N6[C@@H](CCC6)C(N[C@@H](CCCNC(N)=N)C(O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)[C@H](CS)N |
