| Synonym(s): |
AP; APS; Ammonium peroxodisulfate; Ammonium peroxydisulfate; PER |
| Formula: |
(NH4)2S2O8 |
| Description: |
Ammonium persulfate (APS) is a widely used reagent in biochemistry and molecular biology for the preparation of polyacrylamide gels. APS forms oxygen free radicals in aqueous solution by a base-catalyzed mechanism. |
| Application: |
Ammonium persulfate has been used for the preparation of polyacrylamide gels and acrylamide hydrogels. |
| Quality Level: |
200 |
| Form: |
Powder |
| Storage Class Code: |
5.1B - Oxidizing hazardous materials |
| CAS Number: |
7727-54-0 |
| Molecular Weight: |
228.2 |
| EC Number: |
231-786-5 |
| MDL Number: |
MFCD00003390 |
| Grade: |
For molecular biology |
| Vapor Density: |
7.9 (vs air) |
| Assay: |
≥ 98% |
| Reaction Suitability: |
Reagent type: oxidant |
| Technique(S): |
Electrophoresis: suitable |
| Anion Traces: |
Chloride (Cl-): < 10 ppm |
| Cation Traces: |
Fe: < 10 ppm
Heavy metals (as Pb): < 50 ppm |
| Foreign Activity: |
DNAse, none detected
Protease, none detected
RNAse, none detected |
| SMILES String: |
N.N.OS(=O)(=O)OOS(O)(=O)=O |
| InChI: |
1S/2H3N.H2O8S2/c;;1-9(2,3)7-8-10(4,5)6/h2*1H3;(H,1,2,3)(H,4,5,6) |
| InChI key: |
ROOXNKNUYICQNP-UHFFFAOYSA-N |
